C27H25N3O4S2 — CID 99936210
[(1R)-2-(1,3-benzodioxol-5-ylamino)-2-oxo-1-phenylethyl] (1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate (PubChem CID 99936210) has the molecular formula C27H25N3O4S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is [(1R)-2-(1,3-benzodioxol-5-ylamino)-2-oxo-1-phenylethyl] (1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate.
| Compound Name | [(1R)-2-(1,3-benzodioxol-5-ylamino)-2-oxo-1-phenylethyl] (1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
|---|---|
| PubChem CID | 99936210 |
| Molecular Formula | C27H25N3O4S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | [(1R)-2-(1,3-benzodioxol-5-ylamino)-2-oxo-1-phenylethyl] (1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)[C@H](SC(=S)N1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2)c1ccccc1 |
| InChI | InChI=1S/C27H25N3O4S2/c31-24-8-4-7-21-19-11-17(14-30(21)24)13-29(15-19)27(35)36-25(18-5-2-1-3-6-18)26(32)28-20-9-10-22-23(12-20)34-16-33-22/h1-10,12,17,19,25H,11,13-16H2,(H,28,32)/t17-,19+,25-/m1/s1 |
| InChIKey | VCRMXIKGKNXMHA-VDABOFBKSA-N |
| XLogP | 4.39 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|