C11H18N2 — CID 99941407
(4aS,5R,7R,7aS)-2,3,5,7-tetramethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine (PubChem CID 99941407) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (4aS,5R,7R,7aS)-2,3,5,7-tetramethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine.
| Compound Name | (4aS,5R,7R,7aS)-2,3,5,7-tetramethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine |
|---|---|
| PubChem CID | 99941407 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (4aS,5R,7R,7aS)-2,3,5,7-tetramethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyrazine |
| SMILES | CC1=N[C@@H]2[C@@H](N=C1C)[C@H](C)C[C@H]2C |
| InChI | InChI=1S/C11H18N2/c1-6-5-7(2)11-10(6)12-8(3)9(4)13-11/h6-7,10-11H,5H2,1-4H3/t6-,7-,10+,11+/m1/s1 |
| InChIKey | DXAPDPKCNTZGKA-QPYBSBGSSA-N |
| XLogP | 2.33 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |