C37H70O7Si3 — CID 99961403
(E,2R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-3-en-2-ol (PubChem CID 99961403) has the molecular formula C37H70O7Si3 and a molecular weight of 711.22 g/mol. Its IUPAC name is (E,2R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-3-en-2-ol.
| Compound Name | (E,2R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-3-en-2-ol |
|---|---|
| PubChem CID | 99961403 |
| Molecular Formula | C37H70O7Si3 |
| Molecular Weight | 711.22 g/mol |
| Exact Mass | 710.44 |
| IUPAC Name | (E,2R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-3-en-2-ol |
| SMILES | CC1(C)O[C@@H]([C@](O)(CO[Si](C)(C)C(C)(C)C)/C(=C/CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C37H70O7Si3/c1-33(2,3)45(12,13)40-24-23-30(26-41-46(14,15)34(4,5)6)37(38,28-42-47(16,17)35(7,8)9)32-31(43-36(10,11)44-32)27-39-25-29-21-19-18-20-22-29/h18-23,31-32,38H,24-28H2,1-17H3/b30-23+/t31-,32-,37+/m1/s1 |
| InChIKey | OFAMITABXAPFJQ-JZBWPASCSA-N |
| XLogP | 9.45 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.22 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|