C12H14N2O5 — CID 99973008
(4S,5R)-5-(dimethylamino)-4-(4-nitrophenyl)-1,3-dioxan-2-one (PubChem CID 99973008) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is (4S,5R)-5-(dimethylamino)-4-(4-nitrophenyl)-1,3-dioxan-2-one.
| Compound Name | (4S,5R)-5-(dimethylamino)-4-(4-nitrophenyl)-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 99973008 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (4S,5R)-5-(dimethylamino)-4-(4-nitrophenyl)-1,3-dioxan-2-one |
| SMILES | CN(C)[C@@H]1COC(=O)O[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H14N2O5/c1-13(2)10-7-18-12(15)19-11(10)8-3-5-9(6-4-8)14(16)17/h3-6,10-11H,7H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | JVHRFDUBKQWSDL-MNOVXSKESA-N |
| XLogP | 1.73 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|