C9H11N3O3 — CID 99975572
4-methyl-2-[2-(methylamino)-2-oxoethyl]pyrimidine-5-carboxylic acid (PubChem CID 99975572) has the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. Its IUPAC name is 4-methyl-2-[2-(methylamino)-2-oxoethyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-methyl-2-[2-(methylamino)-2-oxoethyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 99975572 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 4-methyl-2-[2-(methylamino)-2-oxoethyl]pyrimidine-5-carboxylic acid |
| SMILES | CNC(=O)Cc1ncc(C(=O)O)c(C)n1 |
| InChI | InChI=1S/C9H11N3O3/c1-5-6(9(14)15)4-11-7(12-5)3-8(13)10-2/h4H,3H2,1-2H3,(H,10,13)(H,14,15) |
| InChIKey | HMCRTXINEPZAMS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |