C14H11N3O3S — CID 99978161
3-hydroxy-5-oxo-1-phenyl-N-(1,3-thiazol-2-yl)-2H-pyrrole-4-carboxamide (PubChem CID 99978161) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is 3-hydroxy-5-oxo-1-phenyl-N-(1,3-thiazol-2-yl)-2H-pyrrole-4-carboxamide.
| Compound Name | 3-hydroxy-5-oxo-1-phenyl-N-(1,3-thiazol-2-yl)-2H-pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 99978161 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3-hydroxy-5-oxo-1-phenyl-N-(1,3-thiazol-2-yl)-2H-pyrrole-4-carboxamide |
| SMILES | O=C(Nc1nccs1)C1=C(O)CN(c2ccccc2)C1=O |
| InChI | InChI=1S/C14H11N3O3S/c18-10-8-17(9-4-2-1-3-5-9)13(20)11(10)12(19)16-14-15-6-7-21-14/h1-7,18H,8H2,(H,15,16,19) |
| InChIKey | FYKHWQLMBRMCRB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|