C10H8FNO4 — CID 99984242
(2S,4Z)-6-fluoro-4-hydroxyimino-2,3-dihydrochromene-2-carboxylic acid (PubChem CID 99984242) has the molecular formula C10H8FNO4 and a molecular weight of 225.17 g/mol. Its IUPAC name is (2S,4Z)-6-fluoro-4-hydroxyimino-2,3-dihydrochromene-2-carboxylic acid.
| Compound Name | (2S,4Z)-6-fluoro-4-hydroxyimino-2,3-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 99984242 |
| Molecular Formula | C10H8FNO4 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | (2S,4Z)-6-fluoro-4-hydroxyimino-2,3-dihydrochromene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C/C(=N/O)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C10H8FNO4/c11-5-1-2-8-6(3-5)7(12-15)4-9(16-8)10(13)14/h1-3,9,15H,4H2,(H,13,14)/b12-7-/t9-/m0/s1 |
| InChIKey | JPPKQZNVCIOJQR-PPLKPFPSSA-N |
| XLogP | 1.24 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|