C23H18F3NO4 — CID 99985650
benzyl (1R,5S,6S,7R)-4-oxo-3-[3-(trifluoromethyl)phenyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 99985650) has the molecular formula C23H18F3NO4 and a molecular weight of 429.39 g/mol. Its IUPAC name is benzyl (1R,5S,6S,7R)-4-oxo-3-[3-(trifluoromethyl)phenyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | benzyl (1R,5S,6S,7R)-4-oxo-3-[3-(trifluoromethyl)phenyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 99985650 |
| Molecular Formula | C23H18F3NO4 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | benzyl (1R,5S,6S,7R)-4-oxo-3-[3-(trifluoromethyl)phenyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1[C@H]2C=C[C@@]3(CN(c4cccc(C(F)(F)F)c4)C(=O)[C@@H]13)O2 |
| InChI | InChI=1S/C23H18F3NO4/c24-23(25,26)15-7-4-8-16(11-15)27-13-22-10-9-17(31-22)18(19(22)20(27)28)21(29)30-12-14-5-2-1-3-6-14/h1-11,17-19H,12-13H2/t17-,18-,19-,22+/m1/s1 |
| InChIKey | VYTHPKMZKZLIDA-YXTQBTIXSA-N |
| XLogP | 3.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|