C29H27N3O4 — CID 99993078
(3S)-1-(2,4-dimethoxyphenyl)-3-[(4R)-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pyrrolidine-2,5-dione (PubChem CID 99993078) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is (3S)-1-(2,4-dimethoxyphenyl)-3-[(4R)-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2,4-dimethoxyphenyl)-3-[(4R)-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 99993078 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (3S)-1-(2,4-dimethoxyphenyl)-3-[(4R)-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@H](N3Cc4[nH]c5ccccc5c4[C@@H](c4ccccc4)C3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C29H27N3O4/c1-35-19-12-13-24(26(14-19)36-2)32-27(33)15-25(29(32)34)31-16-21(18-8-4-3-5-9-18)28-20-10-6-7-11-22(20)30-23(28)17-31/h3-14,21,25,30H,15-17H2,1-2H3/t21-,25+/m1/s1 |
| InChIKey | WKCUQDHTZAZWQM-BWKNWUBXSA-N |
| XLogP | 4.46 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|