C29H25N3O4 — CID 93489963
(3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(4R)-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pyrrolidine-2,5-dione (PubChem CID 93489963) has the molecular formula C29H25N3O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is (3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(4R)-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(4R)-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 93489963 |
| Molecular Formula | C29H25N3O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | (3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(4R)-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2Cc3[nH]c4ccccc4c3[C@@H](c3ccccc3)C2)C(=O)N1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C29H25N3O4/c33-27-15-24(29(34)32(27)19-10-11-25-26(14-19)36-13-12-35-25)31-16-21(18-6-2-1-3-7-18)28-20-8-4-5-9-22(20)30-23(28)17-31/h1-11,14,21,24,30H,12-13,15-17H2/t21-,24-/m1/s1 |
| InChIKey | CDLAIBZIIHKBAT-ZJSXRUAMSA-N |
| XLogP | 4.22 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|