C28H23ClFN3O2 — CID 66501725
1-(3-chloro-4-fluorophenyl)-3-(1-methyl-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrrolidine-2,5-dione (PubChem CID 66501725) has the molecular formula C28H23ClFN3O2 and a molecular weight of 487.96 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(1-methyl-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(1-methyl-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 66501725 |
| Molecular Formula | C28H23ClFN3O2 |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(1-methyl-4-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrrolidine-2,5-dione |
| SMILES | CC1c2[nH]c3ccccc3c2C(c2ccccc2)CN1C1CC(=O)N(c2ccc(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C28H23ClFN3O2/c1-16-27-26(19-9-5-6-10-23(19)31-27)20(17-7-3-2-4-8-17)15-32(16)24-14-25(34)33(28(24)35)18-11-12-22(30)21(29)13-18/h2-13,16,20,24,31H,14-15H2,1H3 |
| InChIKey | CDUXMGVMXLOFMM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|