C10H7N3O3 — CID 99993841
(5R)-3-(2-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile (PubChem CID 99993841) has the molecular formula C10H7N3O3 and a molecular weight of 217.18 g/mol. Its IUPAC name is (5R)-3-(2-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile.
| Compound Name | (5R)-3-(2-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile |
|---|---|
| PubChem CID | 99993841 |
| Molecular Formula | C10H7N3O3 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | (5R)-3-(2-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile |
| SMILES | N#C[C@H]1CC(c2ccccc2[N+](=O)[O-])=NO1 |
| InChI | InChI=1S/C10H7N3O3/c11-6-7-5-9(12-16-7)8-3-1-2-4-10(8)13(14)15/h1-4,7H,5H2/t7-/m1/s1 |
| InChIKey | ISBGAIMQIKSEHE-SSDOTTSWSA-N |
| XLogP | 1.61 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|