C18H19N5OS — CID 99994956
(3R)-3-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]tetrazol-5-yl]sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 99994956) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is (3R)-3-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]tetrazol-5-yl]sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3R)-3-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]tetrazol-5-yl]sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 99994956 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (3R)-3-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]tetrazol-5-yl]sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2CC[C@H]1Sc1nnnn1[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C18H19N5OS/c24-17-16(8-7-12-3-1-2-4-14(12)19-17)25-18-20-21-22-23(18)15-10-11-5-6-13(15)9-11/h1-6,11,13,15-16H,7-10H2,(H,19,24)/t11-,13+,15-,16-/m1/s1 |
| InChIKey | OCOPKKJHPVKDAD-WXYCVUISSA-N |
| XLogP | 2.86 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|