About 2-aminopropanoic acid
2-aminopropanoic acid (PubChem CID 602) has the molecular formula C3H7NO2
and a molecular weight of 89.09 g/mol. Its IUPAC name is 2-aminopropanoic acid.
Molecular Properties
| Compound Name | 2-aminopropanoic acid |
| PubChem CID | 602 |
| Molecular Formula | C3H7NO2 |
| Molecular Weight | 89.09 g/mol |
| Exact Mass | 89.05 |
| IUPAC Name | 2-aminopropanoic acid |
| SMILES | CC(N)C(=O)O |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) |
| InChIKey | QNAYBMKLOCPYGJ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.09 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropanoic acid?
The IUPAC name of 2-aminopropanoic acid (CID 602) is 2-aminopropanoic acid.
What is the SMILES notation for 2-aminopropanoic acid?
The canonical SMILES for 2-aminopropanoic acid is CC(N)C(=O)O.
What is the InChIKey of 2-aminopropanoic acid?
The InChIKey is QNAYBMKLOCPYGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6).
What are the key properties of 2-aminopropanoic acid?
2-aminopropanoic acid has a molecular weight of 89.09 g/mol, XLogP of -0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropanoic acid is sourced from PubChem (CID 602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).