C9H18N6 — CID 2123
View drug profile → altretamine2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 2123) has the molecular formula C9H18N6 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 2123 |
| Molecular Formula | C9H18N6 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexamethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C9H18N6/c1-13(2)7-10-8(14(3)4)12-9(11-7)15(5)6/h1-6H3 |
| InChIKey | UUVWYPNAQBNQJQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |