C7H7BrN4O2 — CID 11808
View drug profile → pamabrom8-bromo-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 11808) has the molecular formula C7H7BrN4O2 and a molecular weight of 259.06 g/mol. Its IUPAC name is 8-bromo-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-bromo-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11808 |
| Molecular Formula | C7H7BrN4O2 |
| Molecular Weight | 259.06 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 8-bromo-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(Br)nc2n(C)c1=O |
| InChI | InChI=1S/C7H7BrN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10) |
| InChIKey | SKTFQHRVFFOHTQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.06 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |