C12H11I3N2O4 — CID 2528
View drug profile → metrizoic acid3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoic acid (PubChem CID 2528) has the molecular formula C12H11I3N2O4 and a molecular weight of 627.94 g/mol. Its IUPAC name is 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoic acid.
| Compound Name | 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoic acid |
|---|---|
| PubChem CID | 2528 |
| Molecular Formula | C12H11I3N2O4 |
| Molecular Weight | 627.94 g/mol |
| Exact Mass | 627.79 |
| IUPAC Name | 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoic acid |
| SMILES | CC(=O)Nc1c(I)c(C(=O)O)c(I)c(N(C)C(C)=O)c1I |
| InChI | InChI=1S/C12H11I3N2O4/c1-4(18)16-10-7(13)6(12(20)21)8(14)11(9(10)15)17(3)5(2)19/h1-3H3,(H,16,18)(H,20,21) |
| InChIKey | GGGDNPWHMNJRFN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.94 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|