C7H6ClN3O4S2 — CID 2720
View drug profile → chlorothiazide6-chloro-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 2720) has the molecular formula C7H6ClN3O4S2 and a molecular weight of 295.73 g/mol. Its IUPAC name is 6-chloro-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | 6-chloro-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 2720 |
| Molecular Formula | C7H6ClN3O4S2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 294.95 |
| IUPAC Name | 6-chloro-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NC=NS2(=O)=O |
| InChI | InChI=1S/C7H6ClN3O4S2/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h1-3H,(H,10,11)(H2,9,12,13) |
| InChIKey | JBMKAUGHUNFTOL-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |