C9H9Cl2N3 — CID 2803
View drug profile → clonidineN-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 2803) has the molecular formula C9H9Cl2N3 and a molecular weight of 230.10 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 2803 |
| Molecular Formula | C9H9Cl2N3 |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | Clc1cccc(Cl)c1NC1=NCCN1 |
| InChI | InChI=1S/C9H9Cl2N3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14) |
| InChIKey | GJSURZIOUXUGAL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |