C7H7Cl2NO — CID 18087
View drug profile → clopidol3,5-dichloro-2,6-dimethyl-1H-pyridin-4-one (PubChem CID 18087) has the molecular formula C7H7Cl2NO and a molecular weight of 192.04 g/mol. Its IUPAC name is 3,5-dichloro-2,6-dimethyl-1H-pyridin-4-one.
| Compound Name | 3,5-dichloro-2,6-dimethyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 18087 |
| Molecular Formula | C7H7Cl2NO |
| Molecular Weight | 192.04 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | 3,5-dichloro-2,6-dimethyl-1H-pyridin-4-one |
| SMILES | Cc1[nH]c(C)c(Cl)c(=O)c1Cl |
| InChI | InChI=1S/C7H7Cl2NO/c1-3-5(8)7(11)6(9)4(2)10-3/h1-2H3,(H,10,11) |
| InChIKey | ZDPIZLCVJAAHHR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.04 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |