About cumene
cumene (PubChem CID 7406) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is cumene.
Molecular Properties
| Compound Name | cumene |
| PubChem CID | 7406 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | cumene |
| SMILES | CC(C)c1ccccc1 |
| InChI | InChI=1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | RWGFKTVRMDUZSP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cumene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene?
The IUPAC name of cumene (CID 7406) is cumene.
What is the SMILES notation for cumene?
The canonical SMILES for cumene is CC(C)c1ccccc1.
What is the InChIKey of cumene?
The InChIKey is RWGFKTVRMDUZSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3.
What are the key properties of cumene?
cumene has a molecular weight of 120.19 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene is sourced from PubChem (CID 7406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).