C8H7ClN2O2S — CID 3019
View drug profile → diazoxide7-chloro-3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 3019) has the molecular formula C8H7ClN2O2S and a molecular weight of 230.68 g/mol. Its IUPAC name is 7-chloro-3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 7-chloro-3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 3019 |
| Molecular Formula | C8H7ClN2O2S |
| Molecular Weight | 230.68 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 7-chloro-3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CC1=NS(=O)(=O)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C8H7ClN2O2S/c1-5-10-7-3-2-6(9)4-8(7)14(12,13)11-5/h2-4H,1H3,(H,10,11) |
| InChIKey | GDLBFKVLRPITMI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.68 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |