C6H6Cl2N2O4S2 — CID 3038
View drug profile → dichlorphenamide4,5-dichlorobenzene-1,3-disulfonamide (PubChem CID 3038) has the molecular formula C6H6Cl2N2O4S2 and a molecular weight of 305.16 g/mol. Its IUPAC name is 4,5-dichlorobenzene-1,3-disulfonamide.
| Compound Name | 4,5-dichlorobenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 3038 |
| Molecular Formula | C6H6Cl2N2O4S2 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | 4,5-dichlorobenzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C6H6Cl2N2O4S2/c7-4-1-3(15(9,11)12)2-5(6(4)8)16(10,13)14/h1-2H,(H2,9,11,12)(H2,10,13,14) |
| InChIKey | GJQPMPFPNINLKP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |