C10H15N3 — CID 2368
View drug profile → betanidine1-benzyl-2,3-dimethylguanidine (PubChem CID 2368) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-benzyl-2,3-dimethylguanidine.
| Compound Name | 1-benzyl-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 2368 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-benzyl-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCc1ccccc1 |
| InChI | InChI=1S/C10H15N3/c1-11-10(12-2)13-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H2,11,12,13) |
| InChIKey | NIVZHWNOUVJHKV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|