About iodanium pentanoate
iodanium pentanoate (PubChem CID 87769963) has the molecular formula C5H11IO2
and a molecular weight of 230.04 g/mol. Its IUPAC name is iodanium pentanoate.
Molecular Properties
| Compound Name | iodanium pentanoate |
| PubChem CID | 87769963 |
| Molecular Formula | C5H11IO2 |
| Molecular Weight | 230.04 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | iodanium pentanoate |
| SMILES | CCCCC(=O)[O-].[IH2+] |
| InChI | InChI=1S/C5H10O2.H2I/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H,6,7);1H2/q;+1/p-1 |
| InChIKey | LKAAOQQDIGAZSE-UHFFFAOYSA-M |
| XLogP | -3.60 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.04 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodanium pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodanium pentanoate?
The IUPAC name of iodanium pentanoate (CID 87769963) is iodanium pentanoate.
What is the SMILES notation for iodanium pentanoate?
The canonical SMILES for iodanium pentanoate is CCCCC(=O)[O-].[IH2+].
What is the InChIKey of iodanium pentanoate?
The InChIKey is LKAAOQQDIGAZSE-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O2.H2I/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H,6,7);1H2/q;+1/p-1.
What are the key properties of iodanium pentanoate?
iodanium pentanoate has a molecular weight of 230.04 g/mol, XLogP of -3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iodanium pentanoate is sourced from PubChem (CID 87769963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).