C10H14O4 — CID 3516
View drug profile → guaifenesin3-(2-methoxyphenoxy)propane-1,2-diol (PubChem CID 3516) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-(2-methoxyphenoxy)propane-1,2-diol.
| Compound Name | 3-(2-methoxyphenoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 3516 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-(2-methoxyphenoxy)propane-1,2-diol |
| SMILES | COc1ccccc1OCC(O)CO |
| InChI | InChI=1S/C10H14O4/c1-13-9-4-2-3-5-10(9)14-7-8(12)6-11/h2-5,8,11-12H,6-7H2,1H3 |
| InChIKey | HSRJKNPTNIJEKV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |