C18H20N4O2 — CID 20628
View drug profile → nitracrineN',N'-dimethyl-N-(1-nitroacridin-9-yl)propane-1,3-diamine (PubChem CID 20628) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N',N'-dimethyl-N-(1-nitroacridin-9-yl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(1-nitroacridin-9-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 20628 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N',N'-dimethyl-N-(1-nitroacridin-9-yl)propane-1,3-diamine |
| SMILES | CN(C)CCCNc1c2ccccc2nc2cccc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C18H20N4O2/c1-21(2)12-6-11-19-18-13-7-3-4-8-14(13)20-15-9-5-10-16(17(15)18)22(23)24/h3-5,7-10H,6,11-12H2,1-2H3,(H,19,20) |
| InChIKey | YMVWGSQGCWCDGW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|