1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid

C16H8N2O5 — CID 4846

💊View drug profile → pirenoxine
IUPAC1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid
SMILESO=C(O)c1cc(=O)c2c3nc4ccccc4oc-3cc(=O)c2[nH]1
InChIInChI=1S/C16H8N2O5/c19-9-5-8(16(21)22)18-14-10(20)6-12-15(13(9)14)17-7-3-1-2-4-11(7)23-12/h1-6H,(H,18,19)(H,21,22)
InChIKeyOKPNYGAWTYOBFZ-UHFFFAOYSA-N
MW308.25 g/mol
LogP1.83
Rot. Bonds1

About 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid

1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid (PubChem CID 4846) has the molecular formula C16H8N2O5 and a molecular weight of 308.25 g/mol. Its IUPAC name is 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid.

Molecular Properties

Compound Name1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid
PubChem CID4846
Molecular FormulaC16H8N2O5
Molecular Weight308.25 g/mol
Exact Mass308.04
IUPAC Name1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid
SMILESO=C(O)c1cc(=O)c2c3nc4ccccc4oc-3cc(=O)c2[nH]1
InChIInChI=1S/C16H8N2O5/c19-9-5-8(16(21)22)18-14-10(20)6-12-15(13(9)14)17-7-3-1-2-4-11(7)23-12/h1-6H,(H,18,19)(H,21,22)
InChIKeyOKPNYGAWTYOBFZ-UHFFFAOYSA-N
XLogP1.83
TPSA113.26 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.25
LogP ≤ 51.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid?
The IUPAC name of 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid (CID 4846) is 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid.
What is the SMILES notation for 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid?
The canonical SMILES for 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid is O=C(O)c1cc(=O)c2c3nc4ccccc4oc-3cc(=O)c2[nH]1.
What is the InChIKey of 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid?
The InChIKey is OKPNYGAWTYOBFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8N2O5/c19-9-5-8(16(21)22)18-14-10(20)6-12-15(13(9)14)17-7-3-1-2-4-11(7)23-12/h1-6H,(H,18,19)(H,21,22).
What are the key properties of 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid?
1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid has a molecular weight of 308.25 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid is sourced from PubChem (CID 4846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).