C9H11NO3 — CID 7436
View drug profile → adrenalone1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanone (PubChem CID 7436) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 7436 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-(methylamino)ethanone |
| SMILES | CNCC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H11NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,10-12H,5H2,1H3 |
| InChIKey | PZMVOUYYNKPMSI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|