C4H7NO2S — CID 9934
View drug profile → timonacic1,3-thiazolidine-4-carboxylic acid (PubChem CID 9934) has the molecular formula C4H7NO2S and a molecular weight of 133.17 g/mol. Its IUPAC name is 1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 9934 |
| Molecular Formula | C4H7NO2S |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.02 |
| IUPAC Name | 1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSCN1 |
| InChI | InChI=1S/C4H7NO2S/c6-4(7)3-1-8-2-5-3/h3,5H,1-2H2,(H,6,7) |
| InChIKey | DZLNHFMRPBPULJ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |