C14H18N4O3 — CID 5578
View drug profile → trimethoprim5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 5578) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 5578 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OC |
| InChI | InChI=1S/C14H18N4O3/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-17-14(16)18-13(9)15/h5-7H,4H2,1-3H3,(H4,15,16,17,18) |
| InChIKey | IEDVJHCEMCRBQM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |