About 4-(dimethylamino)-2,2-diphenylpentanamide
4-(dimethylamino)-2,2-diphenylpentanamide (PubChem CID 22565) has the molecular formula C19H24N2O
and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-(dimethylamino)-2,2-diphenylpentanamide.
Molecular Properties
| Compound Name | 4-(dimethylamino)-2,2-diphenylpentanamide |
| PubChem CID | 22565 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 4-(dimethylamino)-2,2-diphenylpentanamide |
| SMILES | CC(CC(C(N)=O)(c1ccccc1)c1ccccc1)N(C)C |
| InChI | InChI=1S/C19H24N2O/c1-15(21(2)3)14-19(18(20)22,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15H,14H2,1-3H3,(H2,20,22) |
| InChIKey | NARHAGIVSFTMIG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(dimethylamino)-2,2-diphenylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-2,2-diphenylpentanamide?
The IUPAC name of 4-(dimethylamino)-2,2-diphenylpentanamide (CID 22565) is 4-(dimethylamino)-2,2-diphenylpentanamide.
What is the SMILES notation for 4-(dimethylamino)-2,2-diphenylpentanamide?
The canonical SMILES for 4-(dimethylamino)-2,2-diphenylpentanamide is CC(CC(C(N)=O)(c1ccccc1)c1ccccc1)N(C)C.
What is the InChIKey of 4-(dimethylamino)-2,2-diphenylpentanamide?
The InChIKey is NARHAGIVSFTMIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O/c1-15(21(2)3)14-19(18(20)22,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15H,14H2,1-3H3,(H2,20,22).
What are the key properties of 4-(dimethylamino)-2,2-diphenylpentanamide?
4-(dimethylamino)-2,2-diphenylpentanamide has a molecular weight of 296.41 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-2,2-diphenylpentanamide is sourced from PubChem (CID 22565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).