About 5-chloro-1,3-benzoxazol-2-amine
5-chloro-1,3-benzoxazol-2-amine (PubChem CID 6103) has the molecular formula C7H5ClN2O
and a molecular weight of 168.58 g/mol. Its IUPAC name is 5-chloro-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 5-chloro-1,3-benzoxazol-2-amine |
| PubChem CID | 6103 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 5-chloro-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C7H5ClN2O/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3H,(H2,9,10) |
| InChIKey | YGCODSQDUUUKIV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-benzoxazol-2-amine?
The IUPAC name of 5-chloro-1,3-benzoxazol-2-amine (CID 6103) is 5-chloro-1,3-benzoxazol-2-amine.
What is the SMILES notation for 5-chloro-1,3-benzoxazol-2-amine?
The canonical SMILES for 5-chloro-1,3-benzoxazol-2-amine is Nc1nc2cc(Cl)ccc2o1.
What is the InChIKey of 5-chloro-1,3-benzoxazol-2-amine?
The InChIKey is YGCODSQDUUUKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3H,(H2,9,10).
What are the key properties of 5-chloro-1,3-benzoxazol-2-amine?
5-chloro-1,3-benzoxazol-2-amine has a molecular weight of 168.58 g/mol, XLogP of 2.06, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-benzoxazol-2-amine is sourced from PubChem (CID 6103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).