About 1-methylnaphthalene
1-methylnaphthalene (PubChem CID 7002) has the molecular formula C11H10
and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-methylnaphthalene.
Molecular Properties
| Compound Name | 1-methylnaphthalene |
| PubChem CID | 7002 |
| Molecular Formula | C11H10 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 1-methylnaphthalene |
| SMILES | Cc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H3 |
| InChIKey | QPUYECUOLPXSFR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylnaphthalene?
The IUPAC name of 1-methylnaphthalene (CID 7002) is 1-methylnaphthalene.
What is the SMILES notation for 1-methylnaphthalene?
The canonical SMILES for 1-methylnaphthalene is Cc1cccc2ccccc12.
What is the InChIKey of 1-methylnaphthalene?
The InChIKey is QPUYECUOLPXSFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H3.
What are the key properties of 1-methylnaphthalene?
1-methylnaphthalene has a molecular weight of 142.20 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylnaphthalene is sourced from PubChem (CID 7002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).