C18H24O8S2 — CID 10002924
dimethyl (2R)-2-[(S)-(4-methylphenyl)sulfinyl]-2-(1-methylsulfonyloxypropyl)cyclopropane-1,1-dicarboxylate (PubChem CID 10002924) has the molecular formula C18H24O8S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is dimethyl (2R)-2-[(S)-(4-methylphenyl)sulfinyl]-2-(1-methylsulfonyloxypropyl)cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl (2R)-2-[(S)-(4-methylphenyl)sulfinyl]-2-(1-methylsulfonyloxypropyl)cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10002924 |
| Molecular Formula | C18H24O8S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | dimethyl (2R)-2-[(S)-(4-methylphenyl)sulfinyl]-2-(1-methylsulfonyloxypropyl)cyclopropane-1,1-dicarboxylate |
| SMILES | CCC(OS(C)(=O)=O)[C@@]1([S@@](=O)c2ccc(C)cc2)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C18H24O8S2/c1-6-14(26-28(5,22)23)18(27(21)13-9-7-12(2)8-10-13)11-17(18,15(19)24-3)16(20)25-4/h7-10,14H,6,11H2,1-5H3/t14?,18-,27-/m0/s1 |
| InChIKey | PFOFJTCDVSIWBH-JCFQMYHSSA-N |
| XLogP | 1.33 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|