C19H26O6S2 — CID 11144145
ethyl 4-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]-2-oxo-5-propyloxolane-3-carboxylate (PubChem CID 11144145) has the molecular formula C19H26O6S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is ethyl 4-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]-2-oxo-5-propyloxolane-3-carboxylate.
| Compound Name | ethyl 4-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]-2-oxo-5-propyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 11144145 |
| Molecular Formula | C19H26O6S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | ethyl 4-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]-2-oxo-5-propyloxolane-3-carboxylate |
| SMILES | CCCC1OC(=O)C(C(=O)OCC)C1C(SC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H26O6S2/c1-5-7-14-15(16(18(21)25-14)17(20)24-6-2)19(26-4)27(22,23)13-10-8-12(3)9-11-13/h8-11,14-16,19H,5-7H2,1-4H3 |
| InChIKey | INAJLVRYTDVNFW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|