C21H30O6S2 — CID 15197466
ethyl 4-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]-2-oxo-5-pentyloxolane-3-carboxylate (PubChem CID 15197466) has the molecular formula C21H30O6S2 and a molecular weight of 442.60 g/mol. Its IUPAC name is ethyl 4-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]-2-oxo-5-pentyloxolane-3-carboxylate.
| Compound Name | ethyl 4-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]-2-oxo-5-pentyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 15197466 |
| Molecular Formula | C21H30O6S2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | ethyl 4-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]-2-oxo-5-pentyloxolane-3-carboxylate |
| SMILES | CCCCCC1OC(=O)C(C(=O)OCC)C1C(SC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H30O6S2/c1-5-7-8-9-16-17(18(20(23)27-16)19(22)26-6-2)21(28-4)29(24,25)15-12-10-14(3)11-13-15/h10-13,16-18,21H,5-9H2,1-4H3 |
| InChIKey | XVZHJPBUJKWSLD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|