C17H29NO — CID 10015635
N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]acetamide (PubChem CID 10015635) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]acetamide.
| Compound Name | N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]acetamide |
|---|---|
| PubChem CID | 10015635 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]acetamide |
| SMILES | CC(=O)NC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C17H29NO/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-18-17(5)19/h8,10,12H,6-7,9,11,13H2,1-5H3,(H,18,19)/b15-10+,16-12+ |
| InChIKey | ZTIOVNSRRZYQRZ-NCZFFCEISA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|