C10H9F4NO4 — CID 10016658
(2R,3S)-2-amino-3-hydroxy-3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)propanoic acid (PubChem CID 10016658) has the molecular formula C10H9F4NO4 and a molecular weight of 283.18 g/mol. Its IUPAC name is (2R,3S)-2-amino-3-hydroxy-3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)propanoic acid.
| Compound Name | (2R,3S)-2-amino-3-hydroxy-3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 10016658 |
| Molecular Formula | C10H9F4NO4 |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | (2R,3S)-2-amino-3-hydroxy-3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)propanoic acid |
| SMILES | COc1c(F)c(F)c([C@H](O)[C@@H](N)C(=O)O)c(F)c1F |
| InChI | InChI=1S/C10H9F4NO4/c1-19-9-5(13)3(11)2(4(12)6(9)14)8(16)7(15)10(17)18/h7-8,16H,15H2,1H3,(H,17,18)/t7-,8+/m1/s1 |
| InChIKey | XDSHRQMACQAICK-SFYZADRCSA-N |
| XLogP | 0.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|