C19H21NO6S — CID 10023352
3-[benzenesulfonyl(propyl)amino]-5-(2-carboxyethyl)benzoic acid (PubChem CID 10023352) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is 3-[benzenesulfonyl(propyl)amino]-5-(2-carboxyethyl)benzoic acid.
| Compound Name | 3-[benzenesulfonyl(propyl)amino]-5-(2-carboxyethyl)benzoic acid |
|---|---|
| PubChem CID | 10023352 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-[benzenesulfonyl(propyl)amino]-5-(2-carboxyethyl)benzoic acid |
| SMILES | CCCN(c1cc(CCC(=O)O)cc(C(=O)O)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21NO6S/c1-2-10-20(27(25,26)17-6-4-3-5-7-17)16-12-14(8-9-18(21)22)11-15(13-16)19(23)24/h3-7,11-13H,2,8-10H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | BFEYHLFXAMKWRO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |