C25H32O4 — CID 10023669
[(9S,10R,13S,14R,17S)-17-[(1S)-1-acetyloxyethyl]-10,13-dimethyl-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 10023669) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is [(9S,10R,13S,14R,17S)-17-[(1S)-1-acetyloxyethyl]-10,13-dimethyl-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(9S,10R,13S,14R,17S)-17-[(1S)-1-acetyloxyethyl]-10,13-dimethyl-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 10023669 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | [(9S,10R,13S,14R,17S)-17-[(1S)-1-acetyloxyethyl]-10,13-dimethyl-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1=CC2=CC=C3[C@@H]4CC[C@H]([C@H](C)OC(C)=O)[C@@]4(C)CC[C@@H]3[C@@]2(C)C=C1 |
| InChI | InChI=1S/C25H32O4/c1-15(28-16(2)26)21-8-9-22-20-7-6-18-14-19(29-17(3)27)10-12-24(18,4)23(20)11-13-25(21,22)5/h6-7,10,12,14-15,21-23H,8-9,11,13H2,1-5H3/t15-,21+,22-,23-,24-,25+/m0/s1 |
| InChIKey | WUBYCDBJYCRLBR-JVCMFLMVSA-N |
| XLogP | 5.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |