C27H43N — CID 143227841
(17S)-10,13-dimethyl-17-(5-methylhexyl)-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-3-amine;methane (PubChem CID 143227841) has the molecular formula C27H43N and a molecular weight of 381.65 g/mol. Its IUPAC name is (17S)-10,13-dimethyl-17-(5-methylhexyl)-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-3-amine;methane.
| Compound Name | (17S)-10,13-dimethyl-17-(5-methylhexyl)-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-3-amine;methane |
|---|---|
| PubChem CID | 143227841 |
| Molecular Formula | C27H43N |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.34 |
| IUPAC Name | (17S)-10,13-dimethyl-17-(5-methylhexyl)-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-3-amine;methane |
| SMILES | C.CC(C)CCCC[C@H]1CCC2C3=CC=C4C=C(N)C=CC4(C)C3CCC21C |
| InChI | InChI=1S/C26H39N.CH4/c1-18(2)7-5-6-8-19-10-12-23-22-11-9-20-17-21(27)13-15-26(20,4)24(22)14-16-25(19,23)3;/h9,11,13,15,17-19,23-24H,5-8,10,12,14,16,27H2,1-4H3;1H4/t19-,23?,24?,25?,26?;/m0./s1 |
| InChIKey | NYEPKTKYEAENKD-AXAREPJSSA-N |
| XLogP | 7.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|