C28H53IN2O — CID 165398870
(NZ)-N-[2,15-dimethyl-14-(5-methylhexyl)-10λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadec-6-en-5-ylidene]hydroxylamine;ethane;methanamine (PubChem CID 165398870) has the molecular formula C28H53IN2O and a molecular weight of 560.65 g/mol. Its IUPAC name is (NZ)-N-[2,15-dimethyl-14-(5-methylhexyl)-10λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadec-6-en-5-ylidene]hydroxylamine;ethane;methanamine.
| Compound Name | (NZ)-N-[2,15-dimethyl-14-(5-methylhexyl)-10λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadec-6-en-5-ylidene]hydroxylamine;ethane;methanamine |
|---|---|
| PubChem CID | 165398870 |
| Molecular Formula | C28H53IN2O |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | (NZ)-N-[2,15-dimethyl-14-(5-methylhexyl)-10λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadec-6-en-5-ylidene]hydroxylamine;ethane;methanamine |
| SMILES | CC.CC(C)CCCCC1CCC2I3CCC4=C/C(=N\O)CCC4(C)C3CCC12C.CN |
| InChI | InChI=1S/C25H42INO.C2H6.CH5N/c1-18(2)7-5-6-8-19-9-10-22-24(19,3)15-12-23-25(4)14-11-21(27-28)17-20(25)13-16-26(22)23;2*1-2/h17-19,22-23,28H,5-16H2,1-4H3;1-2H3;2H2,1H3/b27-21-;; |
| InChIKey | ROPKRTTXPDWPEK-QJRDBELESA-N |
| XLogP | 8.22 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|