C33H46O6 — CID 10370013
[(9S,10R,11R,13R,14R,17R)-3-acetyloxy-17-[(2R)-6-acetyloxy-6-methylheptan-2-yl]-10,13-dimethyl-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-11-yl] acetate (PubChem CID 10370013) has the molecular formula C33H46O6 and a molecular weight of 538.73 g/mol. Its IUPAC name is [(9S,10R,11R,13R,14R,17R)-3-acetyloxy-17-[(2R)-6-acetyloxy-6-methylheptan-2-yl]-10,13-dimethyl-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-11-yl] acetate.
| Compound Name | [(9S,10R,11R,13R,14R,17R)-3-acetyloxy-17-[(2R)-6-acetyloxy-6-methylheptan-2-yl]-10,13-dimethyl-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-11-yl] acetate |
|---|---|
| PubChem CID | 10370013 |
| Molecular Formula | C33H46O6 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | [(9S,10R,11R,13R,14R,17R)-3-acetyloxy-17-[(2R)-6-acetyloxy-6-methylheptan-2-yl]-10,13-dimethyl-11,12,14,15,16,17-hexahydro-9H-cyclopenta[a]phenanthren-11-yl] acetate |
| SMILES | CC(=O)OC1=CC2=CC=C3[C@H]([C@H](OC(C)=O)C[C@]4(C)[C@@H]([C@H](C)CCCC(C)(C)OC(C)=O)CC[C@@H]34)[C@@]2(C)C=C1 |
| InChI | InChI=1S/C33H46O6/c1-20(10-9-16-31(5,6)39-23(4)36)27-13-14-28-26-12-11-24-18-25(37-21(2)34)15-17-32(24,7)30(26)29(38-22(3)35)19-33(27,28)8/h11-12,15,17-18,20,27-30H,9-10,13-14,16,19H2,1-8H3/t20-,27-,28+,29-,30-,32+,33-/m1/s1 |
| InChIKey | OVPUBPZIZPFDOM-YCIHJTDFSA-N |
| XLogP | 7.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|