C17H17F3O6S — CID 10024284
benzyl-[(2,5-dimethoxyphenyl)methylidene]oxidanium;trifluoromethanesulfonate (PubChem CID 10024284) has the molecular formula C17H17F3O6S and a molecular weight of 406.38 g/mol. Its IUPAC name is benzyl-[(2,5-dimethoxyphenyl)methylidene]oxidanium;trifluoromethanesulfonate.
| Compound Name | benzyl-[(2,5-dimethoxyphenyl)methylidene]oxidanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10024284 |
| Molecular Formula | C17H17F3O6S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | benzyl-[(2,5-dimethoxyphenyl)methylidene]oxidanium;trifluoromethanesulfonate |
| SMILES | COc1ccc(OC)c(/C=[O+]/Cc2ccccc2)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H17O3.CHF3O3S/c1-17-15-8-9-16(18-2)14(10-15)12-19-11-13-6-4-3-5-7-13;2-1(3,4)8(5,6)7/h3-10,12H,11H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | SVMMZDLTLXNBQW-UHFFFAOYSA-M |
| XLogP | 3.30 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|