C22H22F3N5O — CID 10025638
6-[[5-[2-(4-ethyl-2-fluoroanilino)-3,4-difluorophenyl]-1,3,4-oxadiazol-2-yl]amino]hexanenitrile (PubChem CID 10025638) has the molecular formula C22H22F3N5O and a molecular weight of 429.45 g/mol. Its IUPAC name is 6-[[5-[2-(4-ethyl-2-fluoroanilino)-3,4-difluorophenyl]-1,3,4-oxadiazol-2-yl]amino]hexanenitrile.
| Compound Name | 6-[[5-[2-(4-ethyl-2-fluoroanilino)-3,4-difluorophenyl]-1,3,4-oxadiazol-2-yl]amino]hexanenitrile |
|---|---|
| PubChem CID | 10025638 |
| Molecular Formula | C22H22F3N5O |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 6-[[5-[2-(4-ethyl-2-fluoroanilino)-3,4-difluorophenyl]-1,3,4-oxadiazol-2-yl]amino]hexanenitrile |
| SMILES | CCc1ccc(Nc2c(-c3nnc(NCCCCCC#N)o3)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C22H22F3N5O/c1-2-14-7-10-18(17(24)13-14)28-20-15(8-9-16(23)19(20)25)21-29-30-22(31-21)27-12-6-4-3-5-11-26/h7-10,13,28H,2-6,12H2,1H3,(H,27,30) |
| InChIKey | OAPAMSHYKVVXCR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 86.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|