C21H21F3IN5O — CID 10325075
5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-(2-piperidin-1-ylethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 10325075) has the molecular formula C21H21F3IN5O and a molecular weight of 543.33 g/mol. Its IUPAC name is 5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-(2-piperidin-1-ylethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-(2-piperidin-1-ylethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 10325075 |
| Molecular Formula | C21H21F3IN5O |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | 5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-(2-piperidin-1-ylethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Fc1cc(I)ccc1Nc1c(-c2nnc(NCCN3CCCCC3)o2)ccc(F)c1F |
| InChI | InChI=1S/C21H21F3IN5O/c22-15-6-5-14(19(18(15)24)27-17-7-4-13(25)12-16(17)23)20-28-29-21(31-20)26-8-11-30-9-2-1-3-10-30/h4-7,12,27H,1-3,8-11H2,(H,26,29) |
| InChIKey | NKLYHJGKBKAXHL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|