C18H15F3IN5O2 — CID 167239585
N-[2-[[5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]acetamide (PubChem CID 167239585) has the molecular formula C18H15F3IN5O2 and a molecular weight of 517.25 g/mol. Its IUPAC name is N-[2-[[5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 167239585 |
| Molecular Formula | C18H15F3IN5O2 |
| Molecular Weight | 517.25 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | N-[2-[[5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nnc(-c2ccc(F)c(F)c2Nc2ccc(I)cc2F)o1 |
| InChI | InChI=1S/C18H15F3IN5O2/c1-9(28)23-6-7-24-18-27-26-17(29-18)11-3-4-12(19)15(21)16(11)25-14-5-2-10(22)8-13(14)20/h2-5,8,25H,6-7H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | KCCMWNGAAWZXJC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|