C35H40O4SSi — CID 10031224
[[(4S,5S)-2,2-dimethyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]-phenylsulfanylmethoxy]-trimethylsilane (PubChem CID 10031224) has the molecular formula C35H40O4SSi and a molecular weight of 584.85 g/mol. Its IUPAC name is [[(4S,5S)-2,2-dimethyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]-phenylsulfanylmethoxy]-trimethylsilane.
| Compound Name | [[(4S,5S)-2,2-dimethyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]-phenylsulfanylmethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 10031224 |
| Molecular Formula | C35H40O4SSi |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | [[(4S,5S)-2,2-dimethyl-5-(trityloxymethyl)-1,3-dioxolan-4-yl]-phenylsulfanylmethoxy]-trimethylsilane |
| SMILES | CC1(C)O[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](C(O[Si](C)(C)C)Sc2ccccc2)O1 |
| InChI | InChI=1S/C35H40O4SSi/c1-34(2)37-31(32(38-34)33(39-41(3,4)5)40-30-24-16-9-17-25-30)26-36-35(27-18-10-6-11-19-27,28-20-12-7-13-21-28)29-22-14-8-15-23-29/h6-25,31-33H,26H2,1-5H3/t31-,32-,33?/m0/s1 |
| InChIKey | FIXBGLMLCMZTHO-KOPQTXDBSA-N |
| XLogP | 8.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|