C10H8N2O2S — CID 10036396
2-(2,6-dimethyl-1,1-dioxothiopyran-4-ylidene)propanedinitrile (PubChem CID 10036396) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-(2,6-dimethyl-1,1-dioxothiopyran-4-ylidene)propanedinitrile.
| Compound Name | 2-(2,6-dimethyl-1,1-dioxothiopyran-4-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 10036396 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 2-(2,6-dimethyl-1,1-dioxothiopyran-4-ylidene)propanedinitrile |
| SMILES | CC1=CC(=C(C#N)C#N)C=C(C)S1(=O)=O |
| InChI | InChI=1S/C10H8N2O2S/c1-7-3-9(10(5-11)6-12)4-8(2)15(7,13)14/h3-4H,1-2H3 |
| InChIKey | QYMVCBWCWBVJAV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|